Zu "142434-81-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
4-Phosphonomethylphenylalanine
Artikelnummer: Cay45209-10
A synthetic non-proteinogenic amino acid, a phosphatase-stable phosphotyrosine mimetic, has been used in the synthesis of phosphorylated peptides. SMILES: O=P(O)(O)CC1=CC=C(C=C1)C[C@H](N)C(O)=O. InChi Code:...
| Schlagworte: | p-(Phosphonomethyl)phenylalanine, 4-(phosphonomethyl)-L-phenylalanine |
| Anwendung: | Synthetic non-proteinogenic amino acid |
| CAS | 142434-81-9 |
| MW: | 259.2 D |
ab 55,00 €
L-4-(Phosphonomethyl)- Phe-OH
Artikelnummer: CSB-DT2551.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 142434-81-9 |
| MW: | 259.198 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
