Zu "1421923-86-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(E)-KPT-330
Artikelnummer: Cay39562-1
(E)-KPT-330 is a metabolite of the exportin 1 (XPO1/CRM1) inhibitor selinexor. It is formed from selinexor by the cytochrome P450 (CYP) isoform CYP3A4.Formal Name: 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl]-, 2-(2-pyrazinyl)hydrazide, (2E)-2-propenoic acid. CAS Number: 1421923-86-5. Synonyms:...
| Schlagworte: | trans Selinexor, KTP-330, 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl]-, 2-(2-pyrazinyl)hydrazide,... |
| Anwendung: | Selinexor metabolite |
| CAS | 1421923-86-5 |
| MW: | 443.3 D |
ab 40,00 €
KPT-330
Artikelnummer: LKT-K6276.1
CRM1-selective inhibitor of nuclear export.
| Schlagworte: | Selinexor |
| Anwendung: | CRM1-selective inhibitor of nuclear export |
| CAS | 1421923-86-5 |
| MW: | 443.31 D |
ab 116,00 €
(E)-KPT330
Artikelnummer: TGM-T1844-100mg
Description: (E)-KPT330 is a CRM1-selective inhibitor of nuclear export. It inhibits protein trafficking from the nucleus and induces cell cycle arrest and apoptosis in mesothelioma cells. Target: CRM1, Others. Smiles: FC(F)(F)c1cc(cc(c1)C(F)(F)F)-c1ncn(\C=C\C(=O)NNc2cnccn2)n1. References: Etchin J, et al. Br J...
| Schlagworte: | (E)-RN, KPT-330, KPT330, KPT 330 |
| Anwendung: | Selinexor metabolite |
| CAS | 1421923-86-5 |
| MW: | 443.31 D |
ab 34,00 €
