Zu "1418131-46-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RSC-133
Artikelnummer: Cay9001839-5
RSC-133 is an indole compound that promotes the reprogramming of human somatic cells to pluripotent stem cells. Specifically, when used at 10 µM with four standard reprogramming factors, it increases the number of human foreskin fibroblasts that express the stem cell marker alkaline phosphatase. RSC-133 induces...
| Schlagworte: | 3-[[(2E)-3-(1H-indol-3-yl)-1-oxo-2-propen-1-yl]amino]-benzamide |
| Anwendung: | Pluripotent stem cell programming |
| CAS | 1418131-46-0 |
| MW: | 305.3 D |
ab 58,00 €
RSC-133
Artikelnummer: TGM-T23271-10mg
Description: promotes the reprogramming of human somatic cells to pluripotent stem cells. Target: Others. Smiles: NC(=O)c1cccc(NC(=O)\C=C\c2c[nH]c3ccccc23)c1
| CAS | 1418131-46-0 |
| MW: | 305.33 D |
ab 125,00 €
