Zu "1418013-75-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NMS-873
Artikelnummer: TGM-T1853-100mg
Description: NMS-873 is a potent and selective allosteric inhibitor of VCP/p97. Target: p97. Smiles: Cc1cc(OCc2nnc(SC3CCCC3)n2-c2cccnc2)ccc1-c1ccc(cc1)S(C)(=O)=O. References: Magnaghi P, et al. Nat Chem Biol. 2013, 9(9), 548-556.
| Anwendung: | VCP inhibitor |
| CAS | 1418013-75-8 |
| MW: | 520.67 D |
ab 40,00 €
NMS-873
Artikelnummer: Cay17674-1
The p97 AAA (ATPase associated with diverse cellular activities) is a ubiquitin-selective chaperone known to play a critical role in the degradation of misfolded membrane and secretory proteins and has been linked to various cellular processes that require unfolding and disassembly of protein complexes....
| Schlagworte: | VCP Inhibitor III,... |
| Anwendung: | VCP inhibitor |
| CAS | 1418013-75-8 |
| MW: | 520.7 D |
ab 53,00 €
NMS-873
Artikelnummer: LKT-N4972.1
Valosin-containing protein inhibitor.
| Schlagworte: | NMS873 |
| Anwendung: | Valosin-containing protein inhibitor |
| CAS | 1418013-75-8 |
| MW: | 520.67 D |
ab 135,00 €
