Zu "1417329-24-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MM-102
Artikelnummer: Cay17699-1
WD-repeat protein 5 (WDR5) is a scaffold protein commonly involved in the formation of nucleosome-modifying protein complexes with histones. It serves as a component of a mixed-lineage leukemia (MLL) methyltransferase complex that targets histone 3 at lysine 4 to upregulate transcription. MM-102 is a potent WDR5/MLL...
| Schlagworte: | 1-[[(2S)-5-[(aminoiminomethyl)amino]-2-[[2-ethyl-2-[(2-methyl-1-oxopropyl)amino]-1-oxobutyl]amino]-1-oxopentyl]amino]-N-[b... |
| Anwendung: | WDR5/MLL interaction inhibitor |
| CAS | 1417329-24-8 |
| MW: | 669.8 D |
ab 49,00 €
MM-102
Artikelnummer: TGM-T6333-100mg
Description: MM-102 (HMTase Inhibitor IX) is a high-affinity peptidomimetic MLL1 inhibitor with an IC50 of 0.4 µM. Target: Histone Methyltransferase. Smiles: C(NC(C1=CC=C(F)C=C1)C2=CC=C(F)C=C2)(=O)C3(NC([C@@H](NC(C(NC(C(C)C)=O)(CC)CC)=O)CCCNC(=N)N)=O)CCCC3. References: Karatas H, et al. J Am Chem Soc. 2013, 135(2),...
| Schlagworte: | MM102, HMTase Inhibitor IX |
| Anwendung: | WDR5/MLL interaction inhibitor |
| CAS | 1417329-24-8 |
| MW: | 669.8 D |
ab 32,00 €
