Zu "1415379-56-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
T807
Artikelnummer: Cay42289-10
T807 is a tau-binding agent. It selectively binds to recombinant tau (Kd = 0. and 16. nM for high- and low-affinity tau binding sites) over 83 receptors, transporters, enzymes, and ion channels in a panel at 10 µM but does bind to monoamine oxidase A (MAO-A) and MAO-B (Kds = 1. and 21 nM, respectively). T807 binds...
| Schlagworte: | 7-(6-fluoro-3-pyridinyl)-5H-pyrido[4,3-b]indole |
| Anwendung: | Tau-binding agent |
| CAS | 1415379-56-4 |
| MW: | 263.3 D |
ab 73,00 €
T807
Artikelnummer: TGM-T19573-100mg
Description: T807 (AV-1451) is a novel tracer of tau positron emission tomography (PET). Target: Microtubule Associated. Smiles: Fc1ccc(cn1)-c1ccc2c(c1)[nH]c1ccncc21. References: Xia CF, et al. [(18)F]T807, a novel tau positron emission tomography imaging agent for Alzheimer's disease. Alzheimers Dement. 2013...
| Schlagworte: | AV-1451 |
| CAS | 1415379-56-4 |
| MW: | 263.27 D |
ab 40,00 €
