Zu "140381-53-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Hericerin
Artikelnummer: Cay39057-1
An isoindolinone with diverse biological activities, inhibits alpha-glucosidase (IC50 = 5.3 µM), cytotoxic to A549 and HeLa cancer cells (IC50s = 49 and 40.5 µM, respectively), induces neurite outgrowth in Neuro2a cells at 25 µM, increases NGF production in C6 cells at 50 µM. Formulation: A solid. InChI:...
| Schlagworte: | Isohericerin, 5-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-2,3-dihydro-4-hydroxy-6-methoxy-2-(2-phenylethyl)-1H-isoindol-1-one |
| Anwendung: | Bioactive isoindolinone |
| CAS | 140381-53-9 |
| MW: | 419.56 D |
ab 93,00 €
Isohericerin
Artikelnummer: TGM-T82030-50mg
Description: Isohericerin is a natural isoindolinone-derived product. Smiles: O=C1C=2C(=C(O)C(C/C=C(/CCC=C(C)C)\C)=C(OC)C2)CN1CCC3=CC=CC=C3
| CAS | 140381-53-9 |
| MW: | 419.56 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
