Zu "1401708-83-5" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dihexa
Artikelnummer: TGM-T7376-100mg
Description: Dihexa (Hexanoyl-Tyr-Ile-Ahx-NH2) is an activator of the hepatocyte growth factor/c-Met (HGF/c-Met) system,it binds to HGF (Kd = 65 pM),and an analog of the peptide angiotensin IV. Target: c-Met/HGFR. Smiles: [C@H](CC1=CC=C(O)C=C1)(C(N[C@H](C(NCCCCCC(N)=O)=O)[C@H](CC)C)=O)NC(CCCCC)=O. References: Mccoy...
| Schlagworte: | Hexanoyl-Tyr-Ile-Ahx-NH2, N-hexanoic-Try-Ile-(6)-amino hexanoic amide, PNB-0408 |
| Anwendung: | HGF dimerization inhibitor |
| CAS | 1401708-83-5 |
| MW: | 504.66 D |
ab 59,00 €
