Zu "139262-76-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
H2L5186303
Artikelnummer: Cay14663-1
H2L5186303 is a selective lysophosphatidic acid 2 (LPA2) receptor antagonist (IC50 = 9 nM in a LPA-elicited calcium mobilization assay). It inhibits LPA1 and LPA3 at much higher concentrations (IC50s = 27,354 and 4,504 nM, respectively).Formal Name:...
| Schlagworte: | (Z,Z)-4,4'-[1,3-phenylenebis(oxy-4,1-phenyleneimino)]bis[4-oxo-2-butenoic acid |
| Anwendung: | LPAR2 antagonist |
| CAS | 139262-76-3 |
| MW: | 488.5 D |
ab 49,00 €
H2L5186303
Artikelnummer: TGM-T22835-100mg
Description: H2L5186303 is an LPA2 antagonist and can be used in studies about asthma treatment. Target: LPA Receptor. Smiles: OC(=O)\C=C/C(=O)Nc1ccc(Oc2cccc(Oc3ccc(NC(=O)\C=C/C(O)=O)cc3)c2)cc1. References: Takahashi K, et al. Lysophosphatidic acid receptor-2 (LPA2) and LPA5 regulate cellular functions during tumor...
| Schlagworte: | ZINC33388081 |
| CAS | 139262-76-3 |
| MW: | 488.45 D |
ab 31,00 €
