Zu "1384424-80-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
A-1070722
Artikelnummer: Cay29783-1
A-1070722 is an inhibitor of glycogen synthase kinase 3beta (GSK3beta, IC50 = 98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMSO: soluble. lambdamax: 229, 302 nm. SMILES: COC1=CC2=C(C=C1)C(NC(NC3=NC(C(F)(F)F)=CC=C3)=O)=CC=N2. InChi Code:...
| Schlagworte: | N-(7-methoxy-4-quinolinyl)-N'-[6-(trifluoromethyl)-2-pyridinyl]-urea |
| Anwendung: | GSK3beta inhibitor |
| CAS | 1384424-80-9 |
| MW: | 362.3 D |
ab 49,00 €
A 1070722
Artikelnummer: TGM-T10202-100mg
Description: A 1070722 is a potent and selective GSK-3 inhibitor, exhibiting high affinity for both GSK-3alpha (Ki = 0.6 nM) and GSK-3beta (Ki = 0.6 nM). It can penetrate the blood-brain barrier (BBB) and accumulate in brain regions, indicating potential use as a PET radiotracer for quantifying GSK-3 in the brain....
| CAS | 1384424-80-9 |
| MW: | 362.31 D |
ab 37,00 €
