Zu "1382799-40-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MK-8719
Artikelnummer: TGM-T12070-100mg
Description: MK-8719 is a highly potent and selective inhibitor of O-GlcNAcase (OGA) [hOGA], with a Ki value of 7.9 nM. Target: Others. Smiles: [H][C@]12O[C@H](C(F)F)[C@@H](O)[C@H](O)[C@@]1([H])N=C(NCC)S2. References: Selnick HG, et al. Discovery of MK-8719, a Potent O-GlcNAcase Inhibitor as a Potential Treatment...
| Anwendung: | O-GlcNAcase (OGA) inhibitor |
| CAS | 1382799-40-7 |
| MW: | 268.28 D |
ab 97,00 €
MK-8719
Artikelnummer: Cay34054-1
MK-8719 is an inhibitor of O-GlcNAcase (OGA, Ki = 7.9 nM for the human enzyme). It is selective for OGA over beta-hexosaminidase (Ki = >10,000 nM for the human enzyme). MK-8719 increases the levels of O-GlcNAcylated proteins in rat PC12 adrenal medulla cells (EC50 = 52.7 nM). It increases brain levels of...
| Schlagworte: | 5S-(difluoromethyl)-2-(ethylamino)-3aR,6S,7R,7aR-tetrahydro-5H-pyrano[3,2-d]thiazole-6,7-diol |
| Anwendung: | O-GlcNAcase (OGA) inhibitor |
| CAS | 1382799-40-7 |
| MW: | 268.3 D |
ab 75,00 €
