Zu "1374248-81-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Atogepant
Artikelnummer: TGM-T26682-100mg
Description: Atogepant is an antagonist of calcitonin gene-related peptide receptor. Target: Others. Smiles: [H][C@]1(C[C@H](NC(=O)c2cnc3C[C@]4(Cc3c2)C(=O)Nc2ncccc42)C(=O)N(CC(F)(F)F)[C@@H]1C)c1c(F)ccc(F)c1F
| Schlagworte: | MK 8031, MK-8031, MK8031. Atogepant |
| Anwendung: | Targets calcitonin receptor-like (CALCRL) |
| CAS | 1374248-81-3 |
| MW: | 603.52 D |
ab 1.791,00 €
Atogepant
Artikelnummer: Cay35899-1
Atogepant is an antagonist of the calcitonin gene-related peptide (CGRP) receptor (IC50 = 0.026 nM). It is selective for the CGRP receptor over the adrenomedullin receptors (AM1) and AM2, calcitonin (CT) receptor, amylin receptor 1 (AMY1), and AMY3 receptor (IC50s = >18,000, 400, 6,274, 2.4 and 1,418 nM,...
| Schlagworte: | (3'S)-1',2',5,7-tetrahydro-N-[(3S,5S,6R)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)-3-piperidinyl]-... |
| Anwendung: | CGRP receptor (CALCRL) antagonist |
| CAS | 1374248-81-3 |
| MW: | 603.5 D |
259,00 €
