Zu "137234-62-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Voriconazole
Artikelnummer: LKT-V5886.100
Triazole, 14alpha demethylase inhibitor.
| Schlagworte: | (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| Anwendung: | Antifungal |
| CAS | 137234-62-9 |
| MW: | 349.31 D |
ab 262,00 €
Voriconazole
Artikelnummer: Cay15633-25
Voriconazole is a triazole antifungal agent and a derivative of fluconazole (Cay-11594). It is active against a variety of yeast and fungi, including clinical isolates of A. flavus, A. fumigatus, F. oxysporum, F. solani, C. albicans, and C. neoformans (MICs = C. albicans (MICs = 0.015-8 µg/ml). It inhibits...
| Schlagworte: | DRG 0301, UK 109496, VRC,... |
| Anwendung: | Sterol 14alpha-demethylase inhibitor, antifungal agent |
| CAS | 137234-62-9 |
| MW: | 349.3 D |
ab 123,00 €
Voriconazole
Artikelnummer: TGM-T0120-100mg
Description: Voriconazole (UK-109496) is a triazole antifungal agent that specifically inhibits STEROL 14-ALPHA-DEMETHYLASE and CYTOCHROME P-450 [CYP3A]. Target: Antifection, Antifungal. Smiles: CC(C1=NC=NC=C1F)C(O)(CN1C=NC=N1)C1=CC=C(F)C=C1F. References: Espinel-Ingroff A, et al. J Clin Microbiol, 1998, 36(1),...
| Schlagworte: | UK-109496 |
| CAS | 137234-62-9 |
| MW: | 349.31 D |
ab 30,00 €
