Zu "1370046-40-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SSE15206
Artikelnummer: Cay42961-10
SSE15206 is an inhibitor of tubulin polymerization. It inhibits microtubule polymerization in A549 cells when used at concentrations of 1. and 2. µM. SSE15206 (0. µM) induces cell cycle arrest at the G2/M phase in HCT116 cells. It inhibits the growth of a panel of nine breast, lung, colorectal, cervical, and ovarian...
| Schlagworte: | 4,5-dihydro-3-phenyl-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole-1-carbothioamide |
| Anwendung: | Tubulin polymerization inhibitor |
| CAS | 1370046-40-4 |
| MW: | 371.46 D |
ab 49,00 €
SSE15206
Artikelnummer: TGM-T5699-100mg
Description: SSE15206 is a microtubule polymerization inhibitor that overcomes multidrug resistance, causing aberrant mitosis and resulting in G2/M arrest due to incomplete spindle formation in cancer cells. Target: Microtubule Associated, Apoptosis. Smiles: COc1cc(cc(OC)c1OC)C1CC(=NN1C(N)=S)c1ccccc1. References:...
| CAS | 1370046-40-4 |
| MW: | 371.45 D |
ab 30,00 €
