Zu "136790-76-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lubiprostone
Artikelnummer: TGM-T6307-100mg
Description: Lubiprostone (RU-0211), an activator of ClC-2 chloride channels, is used in the therapy of idiopathic chronic constipation. Target: Chloride channel. Smiles: CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O. References: Bijvelds MJ, et al. Gastroenterology, 2009, 137(3), 976-1985.
| Schlagworte: | RU-0211, SPI-0211 |
| Anwendung: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.46 D |
ab 46,00 €
Lubiprostone
Artikelnummer: Cay10010487-10
Lubiprostone is an activator of chloride channel protein 2 (ClC-2) and a bicyclic derivative of prostaglandin E1 (PGE1, Cay-13010). It induces chloride currents in HEK293 cells expressing recombinant human ClC-2 (EC50 = ~17 nM), but not CFTR, chloride channels. Lubiprostone (1 µM) induces short-circuit currents, a...
| Schlagworte: | RU-0211, SPI-0211, 16,16-difluoro-11alpha-hydroxy-9,15-dioxo-prostan-1-oic acid |
| Anwendung: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.5 D |
ab 85,00 €
