Zu "136181-87-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Palmitoyl Dopamine
Artikelnummer: Cay10007697-5
Several different fatty acyl dopamine analogs, such as N-arachidonoyl dopamine (NADA), N-oleoyl dopamine (ODA) and N-palmitoyl dopamine (PALDA), have been isolated and characterized from bovine brain. Structurally, PALDA is the amide of palmitic acid and dopamine and is therefore a "hybrid" analog which incorporates...
| Schlagworte: | PALDA, N-[2-(3,4-dihydroxyphenyl)ethyl]-hexadecanamide |
| Anwendung: | Bioactive lipid assays |
| CAS | 136181-87-8 |
| MW: | 391.6 D |
ab 74,00 €
PALDA
Artikelnummer: TGM-T23118-10mg
Description: PALDA (N-Palmitoyl dopamine) is a fatty acid dopamine found in the mammalian brain that is inactive against TRPV1 and inactivates at TRPV(1)R. It is used in the study of duodenal ulcers. Target: Others. Smiles: O=C(NCCC1=CC=C(O)C(O)=C1)CCCCCCCCCC CCCCC
| Schlagworte: | N-Palmitoyl dopamine |
| CAS | 136181-87-8 |
| MW: | 391.59 D |
ab 39,00 €
