Zu "1359164-11-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR2211
Artikelnummer: TGM-T16929-100mg
Description: SR2211 is a specific modulator and an inverse agonist of RORgamma(IC50 = 320 nM, Ki = 105 nM). Target: ROR. Smiles: OC(c1ccc(c(F)c1)-c1ccc(CN2CCN(Cc3ccncc3)CC2)cc1)(C(F)(F)F)C(F)(F)F. References: Kumar N, et al. Identification of SR2211: a potent synthetic RORgamma-selective modulator. ACS Chem Biol....
| Anwendung: | ROR gamma agonist |
| CAS | 1359164-11-6 |
| MW: | 527.48 D |
ab 45,00 €
SR 2211
Artikelnummer: Cay11972-1
Retinoic acid receptor-related nuclear receptor gamma (RORgamma) plays a central role in T cell differentiation, particularly in the differentiation of pro-inflammatory TH17 cells, which are implicated in autoimmune diseases like multiple sclerosis and rheumatoid arthritis. SR 2211 selectively binds RORgamma (Ki =...
| Schlagworte: | 2-fluoro-4'-[[4-(4-pyridinylmethyl)-1-piperazinyl]methyl]-alpha,alpha-bis(trifluoromethyl)-[1,1'-biphenyl]-4-methanol |
| Anwendung: | ROR gamma agonist |
| CAS | 1359164-11-6 |
| MW: | 527.5 D |
ab 52,00 €
