Zu "135513-21-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Variculanol
Artikelnummer: Cay29064-1
Variculanol is a sesquiterpene that has been found in A. variecolor.Formal Name: (1R,2R,3aS,4R,5E,8aR,11aR,12E,14aS)-1,2,3,3a,4,7,8,8a,9,10,11,11a,14,14a-tetradecahydro-3a,6,12-trimethyl-9-methylene-1-(1-methylethyl)-dicyclopenta[a,f]cyclododecene-2,4-diol. CAS Number: 135513-21-2. Molecular Formula: C25H40O2....
| Schlagworte: | (1R,2R,3aS,4R,5E,8aR,11aR,12E,14aS)-1,2,3,3a,4,7,8,8a,9,10,11,11a,14,14a-tetradecahydro-3a,6,12-trimethyl-9-methylene-1-(1... |
| Anwendung: | Sesquiterpene |
| CAS | 135513-21-2 |
| MW: | 372.6 D |
281,00 €
Variculanol
Artikelnummer: TGM-T85053-10mg
Description: Variculanol, a compound with antimicrobial, anticancer, and anti-HCV NS3/4A protease properties, is derived from the marine fungus Aspergillus versicolor [1]. Target: Others. Smiles: CC12C(C(C(C)C)C(O)C1)CC=C(C)C3C(CCC(C)=CC2O)C(=C)CC3
| CAS | 135513-21-2 |
| MW: | 372.58 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
