Zu "1353016-70-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DBCO-acid
Artikelnummer: TGM-T15057-100mg
Description: DBCO-acid is a cleavable ADC linker utilized in the synthesis of ADC linker DBCO-NHS ester and drug-linker conjugates DBCO-PEG-MMAE[1]. Target: ADC Linker, Others. Smiles: OC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc12. References: Zimmerman ES, et al. Production of site-specific antibody-drug conjugates using...
| CAS | 1353016-70-2 |
| MW: | 305.33 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
DBCO-acid
Artikelnummer: CSB-DT1757.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Anwendung: | Click chemistry |
| CAS | 1353016-70-2 |
| MW: | 305.333 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
DBCO acid
Artikelnummer: Cay41894-1
A copper-free click chemistry reagent, has been used in the study of glycoprotein charge effects on the migration and invasion of 9-azido sialic acid-labeled cancer cells in vitro, has also been used in the synthesis of DBCO-modified RNase A to deliver RNase A into AAM-labeled cancer cells in vitro and in vivo to...
| Schlagworte: | Dibenzocyclooctyne Acid, 11,12-didehydro-?-oxo-dibenz[b,f]azocine-5(6H)-butanoic acid |
| Anwendung: | Copper-free click chemistry reagent |
| CAS | 1353016-70-2 |
| MW: | 305.33 D |
ab 43,00 €
