Zu "1351586-50-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lipid-based Drug Delivery-Tools
L-319
Artikelnummer: Cay35051-10
L-319 is an ionizable cationic (pKa = 6.38) and biodegradable lipid that has been used in the formation of lipid nanoparticles (LNPs). Administration of mouse factor VII-targeting siRNA in L-319-containing LNPs induces factor VII silencing in mice.Formal Name: 9-[4-(dimethylamino)-1-oxobutoxy]-heptadecanedioic acid,...
| Schlagworte: | 9-[4-(dimethylamino)-1-oxobutoxy]-heptadecanedioic acid, 1,17-di-(2Z)-2-nonen-1-yl ester |
| Anwendung: | Ionizable, biodegradable lipid |
| CAS | 1351586-50-9 |
| MW: | 678 D |
ab 134,00 €
L319
Artikelnummer: TGM-T41324-100mg
Description: L319 (Di((Z)-Non-2-en-1-yl) 9-((4-(dimethylamino)butanoyl)oxy)heptadecanedioate) is a lipid membrane, a potential nucleic acid carrier. Target: Others, Liposome. Smiles: CCCCCC\C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC\C=C/CCCCCC)OC(=O)CCCN(C)C. References: Maier MA, Jayaraman M, Matsuda S, et al....
| Schlagworte: | Di((Z)-Non-2-en-1-yl) 9-((4-(dimethylamino)butanoyl)oxy)heptadecanedioate |
| CAS | 1351586-50-9 |
| MW: | 678.04 D |
ab 48,00 €
