Zu "1346547-00-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK583
Artikelnummer: Cay19739-10
GSK583 is a selective inhibitor of RIP-like interacting CLARP kinase (RICK also known as RIP2 kinase, IC50 = 5 nM). RIP2 Kinase is a central component of the innate immune system and enables downstream signaling following activation of the pattern recognition receptors NOD1 and NOD2, leading to the production of...
| Schlagworte: | 6-[(1,1-dimethylethyl)sulfonyl]-N-(5-fluoro-1H-indazol-3-yl)-4-quinolinamine |
| Anwendung: | Selective RIPK2 inhibitor |
| CAS | 1346547-00-9 |
| MW: | 398.5 D |
ab 61,00 €
GSK583
Artikelnummer: TGM-T3537-100mg
Description: GSK583 is a highly effective and specific RIP2 kinase inhibitor (IC50: 5 nM). Target: RIP kinase. Smiles: CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3n[nH]c4ccc(F)cc34)c2c1. References: Haile PA, et al. J Med Chem. 2016, 59(10):4867-80.
| Anwendung: | Selective RIPK2 inhibitor |
| CAS | 1346547-00-9 |
| MW: | 398.45 D |
ab 46,00 €
