Zu "1342278-01-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RKI-1447
Artikelnummer: Cay16278-5
RKI-1447 is an inhibitor of the Rho-associated kinases ROCK1 and 2 (IC50s = 14.5 and 6.2 nM, respectively) that functions by binding to the ATP binding site of the kinase. In cancer cells, RKI-1447 at a concentration of 100 nM has been found to suppress the activation of ROCK substrates myosin light chain (MLC)-2...
| Schlagworte: | N-[(3-hydroxyphenyl)methyl]-N'-[4-(4-pyridinyl)-2-thiazolyl]-urea |
| Anwendung: | ROCK inhibitor |
| CAS | 1342278-01-6 |
| MW: | 326.4 D |
ab 92,00 €
RKI-1447
Artikelnummer: LKT-R4132.1
ROCK1/2 inhibitor.
| Schlagworte: | RKI1447 |
| Anwendung: | ROCK1/2 inhibitor |
| CAS | 1342278-01-6 |
| MW: | 326.37 D |
ab 82,00 €
RKI-1447
Artikelnummer: TGM-T1898-100mg
Description: RKI-1447 is a potent inhibitor of ROCK1 and ROCK2. It has anti-invasive and antitumor activities. Target: ROCK. Smiles: Oc1cccc(CNC(=O)Nc2nc(cs2)-c2ccncc2)c1. References: Patel RA, et al. Cancer Res, 2012, 72(19), 5025-5034.
| Schlagworte: | RKI1447 |
| Anwendung: | ROCK inhibitor |
| CAS | 1342278-01-6 |
| MW: | 326.37 D |
ab 45,00 €
