Zu "13241-28-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Chrysophanol 8-O-glucoside
Artikelnummer: TGM-T3S0381-100mg
Description: Chrysophanol 8-O-glucoside and chrysophanol have mild cytotoxicity and anti-diabetic properties and can play metabolic roles in the insulin-stimulated glucose transport pathway. Target: Serine Protease. Smiles: Cc1cc(O)c2C(=O)c3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cccc3C(=O)c2c1. References: Qi...
| CAS | 13241-28-6 |
| MW: | 416.38 D |
ab 31,00 €
Pulmatin
Artikelnummer: Cay36343-1
Pulmatin is an anthraquinone glycoside that has been found in R. emodi and has diverse biological activities. It inhibits protein tyrosine phosphatase 1B (PTP1B, IC50 = 18.34 µM) and yeast and rat intestinal alpha-glucosidase when used at a concentration of 50 µg/ml. Pulmatin (25 µM) increases insulin-induced...
| Schlagworte: | Chrysophanol 8-O-glucoside, Chrysophanol 8-O-beta-D-glucopyranoside,... |
| Anwendung: | Anthraquinone glycoside |
| CAS | 13241-28-6 |
| MW: | 416.4 D |
ab 133,00 €
