Zu "131860-33-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Azoxystrobin
Artikelnummer: TGM-T21275-50mg
Description: Azoxystrobin (Bankit) is a broad-spectrum fungicide. Azoxystrobin induces ROS production, cell apoptosis and mitochondrial respiration by blocking electron transfer between cytochromes b and c1. Target: Antifungal. Smiles: C(\C(OC)=O)(=C/OC)/C1=C(OC=2C=C(OC3=C(C#N)C=CC=C3)N=CN2)C=CC=C1. References:...
| Schlagworte: | Bankit, Amistar, ICIA-5504, HSDB 7017, ICI-A 5504 |
| CAS | 131860-33-8 |
| MW: | 403.39 D |
ab 38,00 €
Azoxystrobin
Artikelnummer: Cay24056-25
Azoxystrobin is a broad-spectrum beta-methoxyacrylate fungicide (LC95s = o site of mitochondrial complex III, also known as cytochrome bc1 complex, and inhibiting electron transfer. Azoxystrobin is cytotoxic to MDA-kb2 cells with an EC20 value of 2.9 µM but has no antiandrogenic activity. It disrupts mRNA expression...
| Schlagworte: | ICI-A 5504, 2-[[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy]-alphaE-(methoxymethylene)-benzeneacetic acid, methyl ester |
| Anwendung: | Strobilurin fungicide, mitochondrial respiration inhibitor |
| CAS | 131860-33-8 |
| MW: | 403.4 D |
ab 50,00 €
