Zu "13138-33-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3-Aminopropylphosphonic Acid
Artikelnummer: Cay23556-100
3-Aminopropylphosphonic acid (3-APPA) is a phosphonic analog of GABA that acts as a partial agonist of GABAB receptors (IC50 = 1.5 µM in a radioligand binding assay). It induces relaxation in unstimulated isolated guinea pig ileum longitudinal muscle and reverses GABA- and baclofen-induced inhibition of twitch...
| Schlagworte: | 3-APPA, NSC 133832, beta-Aminopropylphosphonic Acid, P-(3-aminopropyl)-phosphonic acid |
| Anwendung: | GABA(B) receptor partial agonist |
| CAS | 13138-33-5 |
| MW: | 139.1 D |
ab 93,00 €
3-Aminopropylphosphonic Acid
Artikelnummer: TGM-T38205-100mg
Description: 3-aminopropylphosphonic acid (3-APPA) is a phosphonic analog of GABA that acts as a partial agonist of GABAB receptors (IC50 = 1.5 µM in a radioligand binding assay). Target: GABA Receptor. Smiles: NCCCP(O)(O)=O
| Anwendung: | GABA(B) receptor partial agonist |
| CAS | 13138-33-5 |
| MW: | 139.09 D |
ab 39,00 €
