Zu "130641-38-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bindarit
Artikelnummer: Cay11479-10
Bindarit is an inhibitor of monocyte chemoattractant protein (MCP) production that is selective for MCP-1/CCL2, MPC-3/CCL7, and MCP-2/CCL8 over other chemokines. It inhibits LPS- or C. albicans-induced production of MCP-1/CCL2 in isolated human monocytes (IC50s = 172 and 403 µM, respectively). Bindarit downregulates...
| Schlagworte: | AF 2838, 2-methyl-2-[[1-(phenylmethyl)-1H-indazol-3-yl]methoxy]-propanoic acid |
| Anwendung: | Monocyte chemotactic protein synthesis inhibitor |
| CAS | 130641-38-2 |
| MW: | 324.4 D |
ab 38,00 €
Bindarit
Artikelnummer: TGM-T6413-10mg
Description: Bindarit (AF2838) displays specific inhibition against monocyte chemotactic proteins MCP-1/CCL2, MCP-3/CCL7 and MCP-2/CCL8. Target: CCR. Smiles: CC(C)(OCc1nn(Cc2ccccc2)c2ccccc12)C(O)=O. References: Zoja C, et al. Kidney Int, 1998, 53(3), 726-734.
| Schlagworte: | AF2838 |
| Anwendung: | Targets C-C motif chemokine 2 (CCL2, MCP1) |
| CAS | 130641-38-2 |
| MW: | 324.37 D |
ab 33,00 €
