Zu "1305267-37-1" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Roginolisib
Roginolisib

Artikelnummer: Cay44445-10

Roginolisib is an inhibitor of PI3Kdelta (IC50 = 0. µM). It is selective for PI3Kdelta over PI3Kalpha, PI3Kbeta, PI3Kgamma, VPS34, and PI3KC2beta (IC50s = 0. 1. 10. 5. and 5. µM, respectively). Roginolisib inhibits the growth of SU-DHL-6 B cell lymphoma cells that endogenously express PI3Kdelta (GI50 = 0. µM) but...
Schlagworte: IOA-244, MSC2360844,...
Anwendung: PI3Kdelta inhibitor
CAS 1305267-37-1
MW: 526.58 D
ab 299,00 €
Bewerten
MSC2360844
MSC2360844

Artikelnummer: TGM-T12115-100mg

Description: MSC2360844 is a potent, orally active and selective inhibitor of PI3Kdelta(IC50 of 145 nM). Target: PI3K. Smiles: Fc1cccc2-c3c(CS(=O)(=O)c12)c(nn3-c1ccc(CN2CCOCC2)cc1)C(=O)N1CCOCC1. References: Haselmayer P, et al. Characterization of Novel PI3Kdelta Inhibitors as Potential Therapeutics for SLE and...
CAS 1305267-37-1
MW: 526.58 D
ab 46,00 €
Bewerten