Zu "129029-23-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Ocaperidone
Ocaperidone

Artikelnummer: TGM-T3497-100mg

Description: Ocaperidona (Ocaperidone (Ocaperidona)), a very high affinity dopamine D2 antagonist. Target: Dopamine Receptor, 5-HT Receptor. Smiles: Cc1cccn2c1nc(C)c(CCN1CCC(CC1)c1noc3cc(F)ccc13)c2=O. References: Hugo Geerts, et al. Blinded Prospective Evaluation of Computer-Based Mechanistic Schizophrenia Disease...
Schlagworte: Ocaperidona, R79598
Anwendung: Targets dopamine receptor D2 (DRD2)
CAS 129029-23-8
MW: 420.48 D
ab 38,00 €
Bewerten
Ocaperidone
Ocaperidone

Artikelnummer: Cay42946-10

Ocaperidone is an atypical antipsychotic that binds to dopamine D2 receptors (Ki = 0. nM), alpha1-adrenergic receptors (alpha1-ARs, Ki = 0. nM), and the serotonin (5-HT) receptor subtype 5-HT2 (Ki = 0. nM). It is selective for these receptors over a panel of 26 additional receptors, transporters, channels, and...
Schlagworte: R 79598, 3-[2-[4-(6-fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-2,9-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one
Anwendung: Atypical antipsychotic
CAS 129029-23-8
MW: 420.49 D
ab 137,00 €
Bewerten