Zu "1286770-55-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Verubecestat
Artikelnummer: Cay21115-5
Verubecestat is an inhibitor of beta-site amyloid precursor protein cleaving enzyme 1 (BACE1) and BACE2 (Kis = 2.2 and 0.38 nM, respectively). It has a high selectivity for BACE1 and BACE2 over closely related aspartyl proteases, including cathepsin D. Formulations containing verubecestat profoundly lower levels of...
| Schlagworte: | MK-8931,... |
| Anwendung: | BACE1 inhibitor |
| CAS | 1286770-55-5 |
| MW: | 409.4 D |
ab 44,00 €
Verubecestat
Artikelnummer: LKT-V182705.100
BACE1 inhibitor
| Schlagworte: | MK-8931, MK8931,... |
| Anwendung: | BACE1 inhibitor |
| CAS | 1286770-55-5 |
| MW: | 409.41 D |
ab 139,00 €
Verubecestat
Artikelnummer: TGM-T7011-100mg
Description: Verubecestat (MK-8931) (MK-8931) is an effective and specific beta-secretase inhibitor and beta-site APP-cleaving enzyme 1 inhibitor or BACE1 protein inhibitor. Target: BACE, Beta-Secretase. Smiles: CN1C(N)=N[C@@](C)(CS1(=O)=O)c1cc(NC(=O)c2ccc(F)cn2)ccc1F. References: Evin G, et al. BioDrugs. 2016,...
| Schlagworte: | MK-8931 |
| Anwendung: | Dementia therapeutic agent, beta-Secretase inhibitor |
| CAS | 1286770-55-5 |
| MW: | 409.41 D |
ab 33,00 €
