Zu "1285702-20-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML-167
Artikelnummer: Cay18098-10
The Cdc2-like kinases (Clks) and the dual-specificity tyrosine phosphorylation-regulated kinases (DYRKs) are involved in regulating gene splicing. Clks phosphorylate serine/arginine-rich proteins, which are a major component of the spliceosome, whereas DYRKs interact with and activate splicing factors. ML167 is a...
| Schlagworte: | CID 44968231, 5-[4-[[(5-methyl-2-furanyl)methyl]amino]-6-quinazolinyl]-2-furanmethanol |
| Anwendung: | Clk4 inhibitor |
| CAS | 1285702-20-6 |
| MW: | 335.4 D |
ab 40,00 €
ML167
Artikelnummer: TGM-T2670-100mg
Description: ML167 (CID44968231) is a highly selective Cdc2-like kinase 4 (Clk4) inhibitor. Target: CDK, DYRK. Smiles: Cc1ccc(CNc2ncnc3ccc(cc23)-c2ccc(CO)o2)o1
| Schlagworte: | NCGC00188654 , CID44968231 |
| CAS | 1285702-20-6 |
| MW: | 335.36 D |
ab 29,00 €
