Zu "128322-44-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MCLA (hydrochloride)
Artikelnummer: Cay18673-1
MCLA is a Cypridina luciferin analog that is used to detect superoxide generated by activated leukocytes and macrophages. It emits chemiluminescence near 654 nm by reaction with superoxide or singlet oxygen.Formal Name: 6-(4-methoxyphenyl)-2-methyl-imidazo[1,2-a]pyrazin-3(7H)-one, monohydrochloride. CAS Number:...
| Schlagworte: | 6-(4-methoxyphenyl)-2-methyl-imidazo[1,2-a]pyrazin-3(7H)-one, monohydrochloride |
| Anwendung: | Chemiluminescent superoxide detection, luciferin analog |
| CAS | 128322-44-1 |
| MW: | 291.7 D |
ab 85,00 €
MCLA hydrochloride
Artikelnummer: TGM-T19024-5mg
Description: MCLA hydrochloride, a chemiluminescent compound, can be used to quantify aqueous concentrations of superoxide. Target: Others. Smiles: Cl.COc1ccc(cc1)-c1cn2c(c[nH]1)nc(C)c2=O. References: Kimura H, et al. Highly sensitive and reliable chemiluminescence method for the assay of superoxide dismutase...
| CAS | 128322-44-1 |
| MW: | 291.73 D |
431,00 €
