Zu "127512-29-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lipid-based Drug Delivery-Tools
1,2-Dioleoyl-3-dimethylammonium-propane
Artikelnummer: Cay25726-10
1,2-Dioleoyl-3-dimethylammonium-propane (DODAP) is an ionizable cationic lipid (pKa = 5.59 in a TNS binding assay). It has been used as a component in liposomes that can be used to encapsulate siRNA, immunostimulatory oligodeoxynucleotides, antisense oligonucleotides, or chemotherapeutic agents for in vitro and in...
| Schlagworte: | 18:1 DAP, DODAP, 9Z-octadecenoic acid, 1,1'-[1-[(dimethylamino)methyl]-1,2-ethanediyl] ester |
| Anwendung: | Cationic lipid, liposome siRNA / oligo / drug delivery |
| CAS | 127512-29-2 |
| MW: | 648.1 D |
ab 53,00 €
DODAP
Artikelnummer: TGM-T38679-10mg
Description: DODAP is an ionic cationic lipid with low cytotoxicity and high transfection efficiency that can be used to synthesize liposomes and encapsulate biologically active molecules such as mRNA, siRNA and plasmid DNA. Target: Liposome. Smiles: C(OC(CCCCCCC/C=C\CCCCCCCC)=O)(COC(CCCCCCC/C=C\CCCCCCCC)=O)CN(C)C
| CAS | 127512-29-2 |
| MW: | 648.05 D |
ab 36,00 €
