Zu "127274-91-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DiD (perchlorate)
Artikelnummer: Cay45033-1
A fluorescent probe for cell membranes, ex/em = 644/663 nm, respectively. SMILES: CC1(C)C2=CC=CC=C2N(CCCCCCCCCCCCCCCCCC)C1=CC=CC=CC3=[N+](CCCCCCCCCCCCCCCCCC)C4=CC=CC=C4C3(C)C.O=Cl(=O)([O-])=O. InChi Code:...
| Schlagworte: | 2-[5-(1,3-dihydro-3,3-dimethyl-1-octadecyl-2H-indol-2-ylidene)-1,3-pentadien-1-yl]-3,3-dimethyl-1-octadecyl-3H-indolium,... |
| Anwendung: | Fluorescent cell membrane probe |
| CAS | 127274-91-3 |
| MW: | 959.92 D |
ab 49,00 €
DiD Perchlorate *UltraPure Grade*
Artikelnummer: ABD-22034
DiI, DiO, DiD and DiR dyes are a family of lipophilic fluorescent stains for labeling membranes and other hydrophobic structures. The fluorescence of these environment-sensitive dyes is greatly enhanced when incorporated into membranes or bound to lipophilic biomolecules such as proteins although they are weakly...
| Anwendung: | Labeling |
| CAS | 127274-91-3 |
| MW: | 959,91 D |
114,00 €
DiD perchlorate
Artikelnummer: TGM-T15118-100mg
Description: DiD perchlorate is a lipophilic cyanine dye that can be used in cells tracking. Target: Others. Smiles: [O-][Cl](=O)(=O)=O.CCCCCCCCCC CCCCCCCCN1C(=CC=CC=CC2=[N+](CCCCCCCCCCCCCCCCCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc12. References: Lo Celso C, et al. Live-animal tracking of individual haematopoietic...
| CAS | 127274-91-3 |
| MW: | 959.9 D |
ab 30,00 €
