Zu "126828-32-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AHK
Artikelnummer: TGM-T80026-50mg
Description: AHK, a bioactive peptide known for its antioxidant properties, has been employed as a cosmetic ingredient [1]. Target: Reactive Oxygen Species. Smiles: C[C@H](N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCCN)C(O)=O
| CAS | 126828-32-8 |
| MW: | 354.4 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Tripeptide-3
Artikelnummer: CSB-DT1704.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Ala-His-Lys, AHK |
| Anwendung: | Cosmetic peptide |
| CAS | 126828-32-8 |
| MW: | 354.409 D |
172,00 €
