Zu "1257852-74-6" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
N-(2-Aminopropyl)maleimide (hydrochloride)
Artikelnummer: Cay45145-100
A heterobifunctional cross-linking reagent, has been used in the synthesis of polyprodrug nanoparticles as anticancer agents. SMILES: O=C1C=CC(N1CCCN)=O.Cl. InChi Code: InChI=1S/C7H10N2O2.ClH/c8-4-1-5-9-6(10)2-3-7(9)11,/h2-3H,1,4-5,8H2,1H. InChi Key: SGVOTZVQRDVUOV-UHFFFAOYSA-N
| Schlagworte: | Mal-NH2, 1-(3-aminopropyl)-1H-pyrrole-2,5-dione, monohydrochloride |
| Anwendung: | Heterobifunctional cross-linking reagent |
| CAS | 1257852-74-6 |
| MW: | 190.63 D |
ab 67,00 €
