Zu "125697-91-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lavendustin B
Artikelnummer: Cay27311-10
Lavendustin B is a competitive inhibitor of glucose transporter 1 (Glut1, Ki = 15 µM). It is also an inhibitor of the interaction between HIV-1 integrase and LEDGF/p75 (IC50 = 94.07 µM). Lavendustin B is a weak inhibitor of tyrosine kinases (IC50 = 0.49 µg/ml) and has been used as a negative control for the protein...
| Schlagworte: | 5-[bis[(2-hydroxyphenyl)methyl]amino]-2-hydroxy-benzoic acid |
| Anwendung: | Competitive glucose transporter 1 (Glut1) inhibitor |
| CAS | 125697-91-8 |
| MW: | 365.4 D |
ab 147,00 €
lavendustin B
Artikelnummer: TGM-T4182-100mg
Description: Lavendustin B is a Tyrosine Kinase Inhibitor and an inhibitor of HIV-1 integrase (IN) interaction with its cognate cellular cofactor, lens epithelium-derived growth factor (LEDGF/p75). Target: HIV Protease, transporter, Tyrosinase. Smiles: OC(=O)c1cc(ccc1O)N(Cc1ccccc1O)Cc1ccccc1O. References:...
| Anwendung: | Competitive glucose transporter 1 (Glut1) inhibitor |
| CAS | 125697-91-8 |
| MW: | 365.38 D |
ab 36,00 €
