Zu "12542-36-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Gossypol-acetic acid
Artikelnummer: LKT-G5875.1
A potential male anti-fertility agent from cotton that exhibits a wide spectrum of toxicity. It was found to have cytotoxic effects on human cancer cell lines. It is a potent telomerase inhibitor.
| Schlagworte: | 1,1',6,6',7,7'-Hexahydroxy-3,3'-dimethyl-5,5'-bis(1- methylethyl)(2,2'-binaphthalene)-8,8'-dicarboxaldehyde-acetic acid,... |
| Anwendung: | Telomerase inhibitor |
| CAS | 12542-36-8 |
| MW: | 578,61 D |
ab 152,00 €
Gossypol (acetic acid)
Artikelnummer: TGM-T2730-100mg
Description: Gossypol acetic acid (AT101), a polyphenolic compound isolated from cottonseeds, binds with Bcl-2, Bcl-xL, Mcl-1, and does not inhibit BIR3 domain and BID. Target: BCL. Smiles: CC(O)=O.CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=O)c2c1O. References: Ciereszko A, et al. Aquat...
| Schlagworte: | Pogosin, (±)-Gossypol-acetic acid, AT101, Gossypol acetic acid |
| CAS | 12542-36-8 |
| MW: | 578.61 D |
ab 30,00 €
