Zu "1246525-60-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR1078
Artikelnummer: TGM-T4594-100mg
Description: SR1078 is an agonist of retinoic acid receptor-related orphan receptor (ROR)alpha/gamma. Target: ROR. Smiles: OC(c1ccc(NC(=O)c2ccc(cc2)C(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F. References: Wang Y, et al. Identification of SR1078, a synthetic agonist for the orphan nuclear receptors RORalpha and RORgamma. ACS...
| Schlagworte: | SR 1078 |
| Anwendung: | ROR alpha / beta agonist |
| CAS | 1246525-60-9 |
| MW: | 431.25 D |
ab 37,00 €
SR 1078
Artikelnummer: Cay16503-5
Retinoic acid receptor-related orphan receptors alpha and gamma (RORalpha and RORgamma) have been demonstrated to play important roles in the regulation of metabolism, circadian rhythms, immune function, and tumorigenesis. SR 1078 is a selective agonist of RORalpha and RORgamma that stimulates ROR transcriptional...
| Schlagworte: | N-[4-[2,2,2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]phenyl]-4-(trifluoromethyl)-benzamide |
| Anwendung: | ROR alpha / beta agonist |
| CAS | 1246525-60-9 |
| MW: | 431.3 D |
ab 44,00 €
