Zu "124555-18-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GR79236
Artikelnummer: Cay28430-1
GR79236 is a selective agonist of adenosine A1 receptors (Kis = 3.1 and 1,300 nM for adenosine A1 and A2 receptors, respectively, in rat brain). GR79236 inhibits cAMP accumulation induced by isoprenaline (isoproterenol, Cay-15592) in DDT1MF-2 hamster smooth muscle cells (IC50 = 2.6 nM) but only decreases...
| Schlagworte: | N-[(1S,2S)-2-hydroxycyclopentyl]-adenosine |
| Anwendung: | Selective adenosine receptor A1 agonist |
| CAS | 124555-18-6 |
| MW: | 351.4 D |
ab 58,00 €
GR79236
Artikelnummer: TGM-TQ0136-2mg
Description: GR79236 is an effective and selective adenosine A1 receptor agonist (Ki: 3.1 nM) that has analgesic and anti-inflammatory actions. Target: Adenosine Receptor. Smiles: OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N[C@H]3CCC[C@@H]3O)ncnc12. References: Sneyd JR, et al. Multicentre evaluation of the adenosine...
| Schlagworte: | GR 79236 |
| Anwendung: | Selective adenosine receptor A1 agonist |
| CAS | 124555-18-6 |
| MW: | 351.36 D |
47,00 €
