Zu "1239987-91-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GPR52 Comp-43
Artikelnummer: Cay33564-10
GPR52 comp-43 is an antagonist of G protein-coupled receptor 52 (GPR52, IC50 = 0.63 µM). It reduces mutant huntingtin (mHTT) protein levels in STHdhQ7/Q111 cells, a heterozygous in vitro model of Huntington's disease, in a concentration-dependent manner. GPR52 comp-43 (3 µM) reduces apoptosis induced by growth...
| Schlagworte: | GPR52-IN-43, (2E)-5-phenyl-1-(2-thienyl)-2-penten-1-one |
| Anwendung: | GPR52 antagonist |
| CAS | 1239987-91-7 |
| MW: | 242.3 D |
ab 95,00 €
CAY10786
Artikelnummer: TGM-T36036-100mg
Description: CAY10786 (GPR52 antagonist-1) is an antagonist of G protein-coupled receptor 52 (GPR52, IC50 = 0.63 µM). Target: Others, GPCR. Smiles: O=C(\C=C\CCc1ccccc1)c1cccs1
| Schlagworte: | GPR52 antagonist-1 |
| Anwendung: | GPR52 antagonist |
| CAS | 1239987-91-7 |
| MW: | 242.34 D |
ab 33,00 €
