Zu "1232410-49-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
VE-821
Artikelnummer: TGM-T3032-100mg
Description: VE-821 (ATR Inhibitor IV) is a selective ATP competitive inhibitor of ATR( Ki/IC50: 13/26 nM in cell-free assays). Target: ATM/ATR. Smiles: CS(=O)(=O)c1ccc(cc1)-c1cnc(N)c(n1)C(=O)Nc1ccccc1. References: Reaper PM, et al. Selective killing of ATM- or p53-deficient cancer cells through inhibition of ATR....
| Schlagworte: | ATR Inhibitor IV |
| Anwendung: | ATR inhibitor |
| CAS | 1232410-49-9 |
| MW: | 368.41 D |
ab 31,00 €
VE-821
Artikelnummer: Cay17587-1
Ataxia-telangiectasia and Rad3-related protein (ATR) is a serine/threonine kinase that activates DNA processes related to the DNA damage response. VE-821 is an ATP-competitive inhibitor of ATR (IC50 = 26 nM). It augments DNA damage and cell death of cancer cells in response to radiation under normal and hypoxic...
| Schlagworte: | ATR Inhibitor IV, 3-amino-6-[4-(methylsulfonyl)phenyl]-N-phenyl-2-pyrazinecarboxamide |
| Anwendung: | ATR inhibitor |
| CAS | 1232410-49-9 |
| MW: | 368.4 D |
ab 44,00 €
VE-821
Artikelnummer: LKT-V1600.10
ATR inhibitor.
| Schlagworte: | VE821 |
| Anwendung: | ATR inhibitor |
| CAS | 1232410-49-9 |
| MW: | 368.41 D |
ab 73,00 €
