Zu "122892-31-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Itopride Hydrochloride
Artikelnummer: LKT-I7757.1
AChE inhibitor, D2 antagonist.
| Schlagworte: | N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4- dimethoxy-benzamide |
| Anwendung: | Acetylcholinesterase inhibitor |
| CAS | 122892-31-3 |
| MW: | 394,88 D |
ab 136,00 €
Itopride (hydrochloride)
Artikelnummer: Cay31183-1
Itopride is an inhibitor of acetylcholinesterase (AChE, IC50 = 1.6 µM for rat stomach enzyme) and a prokinetic agent. It induces contractions in isolated rabbit duodenum when used at concentrations ranging from 1 to 100 µM and enhances ACh-induced contractions in isolated guinea pig stomach circular muscle strips....
| Schlagworte: | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxy-benzamide, monohydrochloride |
| Anwendung: | AChE inhibitor, prokinetic agent |
| CAS | 122892-31-3 |
| MW: | 394.9 D |
ab 85,00 €
Itopride hydrochloride
Artikelnummer: TGM-T1552-100mg
Description: Itopride hydrochloride (Ganaton) is an AChE and D2DR inhibitor. Target: Dopamine Receptor, AChE. Smiles: C(=O)(c1cc(c(cc1)OC)OC)NCc1ccc(cc1)OCCN(C)C.Cl. References: Choung RS, et al. Neurogastroenterol Motil. 2007, 19(3):180-7.
| Schlagworte: | Ganaton, HSR803 |
| Anwendung: | Targets dopamine receptor D2 (DRD2) |
| CAS | 122892-31-3 |
| MW: | 394.9 D |
ab 30,00 €
