Zu "1228445-38-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pyrintegrin
Artikelnummer: TGM-T16695-10mg
Description: Pyrintegrin, a beta1-integrin agonist, promotes the survival of embryonic stem cells, can be used as a podocyte-protective agent, and enhances cell-extracellular matrix adhesion-mediated integrin signaling. Target: Integrin. Smiles: Oc1ccc2N(CCCc2c1)c1ccnc(Nc2ccc(cc2)S(=O)(=O)NCC2CC2)n1. References:...
| CAS | 1228445-38-2 |
| MW: | 451.54 D |
ab 71,00 €
Pyrintegrin
Artikelnummer: Cay16179-1
Human embryonic stem cells (hESC), unlike murine ESC, grow in vitro as large flattened two dimensional colonies. Dispersing these colonies, using trypsin to dissociate single hESC, results in massive cell death. Pyrintegrin is a 2,4-disubstituted pyrimidine that, at 2 µM, enhances the survival of hESC more than...
| Schlagworte: | N-(cyclopropylmethyl)-4-[[4-(3,4-dihydro-6-hydroxy-1(2H)-quinolinyl)-2-pyrimidinyl]amino]-benzenesulfonamide |
| Anwendung: | Human ESC trypsin-mediated dissociation survival enhancer |
| CAS | 1228445-38-2 |
| MW: | 451.5 D |
ab 126,00 €
