Zu "1226895-20-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ATB-346
Artikelnummer: Cay16234-10
ATB-346 is a non-steroidal anti-inflammatory drug (NSAID) that releases hydrogen sulfide (H2S) and a derivative of naproxen (Cay-70290). It inhibits the proliferation of, and induces apoptosis in, A375 melanoma cells when used at a concentration of 100 µM. ATB-346 decreases prostaglandin E2 (PGE2) production in...
| Schlagworte: | 6-methoxy-alpha-methyl-2-naphthaleneacetic acid, 4-(aminothioxomethyl)phenyl ester |
| Anwendung: | Antiinflammatory agent |
| CAS | 1226895-20-0 |
| MW: | 365.5 D |
ab 110,00 €
ATB 346
Artikelnummer: LKT-A7604.1
NSAID, COX inhibitor and HS-releasing agent.
| Anwendung: | NSAID, COX inhibitor and HS-releasing agent |
| CAS | 1226895-20-0 |
| MW: | 365.45 D |
ab 73,00 €
Otenaproxesul
Artikelnummer: TGM-T1867-100mg
Description: Otenaproxesul (ATB 346) is a novel hydrogen sulphide-releasing derivative of naproxen with markedly reduced toxicity. Target: Apoptosis, COX. Smiles: COc1ccc2cc(ccc2c1)C(C)C(=O)Oc1ccc(cc1)C(N)=S. References: Wallace JL, et al. Br J Pharmacol. 2010 Mar,159(6):1236-46.
| Schlagworte: | ATB 346 |
| CAS | 1226895-20-0 |
| MW: | 365.45 D |
ab 33,00 €
