Zu "122555-04-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
H-Phe(4-Ac)-OH
Artikelnummer: TGM-T66400-25mg
Description: H-Phe(4-Ac)-OH, with catalog number T66400 and CAS number 122555-04-8, is a valuable organic compound for life sciences research. Target: Others. Smiles: CC(=O)c1ccc(C[C@H](N)C(O)=O)cc1
| CAS | 122555-04-8 |
| MW: | 207.229 D |
39,00 €
L-4-Acetylphe
Artikelnummer: CSB-DT3255.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 122555-04-8 |
| MW: | 207.229 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
