Zu "1222800-79-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML-324
Artikelnummer: Cay17472-1
ML-324 is a cell-permeable inhibitor of JMJD2E (KDM4DL, IC50 = 920 nM) that is inactive against lysine-specific demethylase, LSD1. It reduces the expression of immediate early genes of Herpes simplex virus (IC50 = ~10 µM) and human cytomegalovirus, blocks viral infection, and suppresses the level of viral...
| Schlagworte: | CID-44143209, N-[3-(dimethylamino)propyl]-4-(8-hydroxy-6-quinolinyl)-benzamide |
| Anwendung: | JMJD2E inhibitor |
| CAS | 1222800-79-4 |
| MW: | 349.4 D |
ab 49,00 €
ML324
Artikelnummer: TGM-T6593-100mg
Description: ML324(IC50=920 nM) is a specific inhibitor of jumonji histone demethylase (JMJD2). Target: Histone Demethylase, HSV, Others. Smiles: CN(C)CCCNC(=O)c1ccc(cc1)-c1cc(O)c2ncccc2c1. References: Rai G, et al. Probe Reports from the NIH Molecular Libraries Program, 2010-2012.
| Anwendung: | JMJD2E inhibitor |
| CAS | 1222800-79-4 |
| MW: | 349.43 D |
ab 45,00 €
