Zu "1221271-55-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DLIN-MC2-DMA
Artikelnummer: TGM-T83655-100mg
Description: DLIN-MC2-DMA (DLin-M-C2-DMA) is a lipid membrane and a potential nucleic acid carrier. Target: Others. Smiles: C(OC(CCN(C)C)=O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC. References: Michael J, et al. Improved amino lipids and methods for the delivery of nucleic acids. WO2010042877A1.
| Schlagworte: | DLin-M-C2-DMA |
| CAS | 1221271-55-1 |
| MW: | 628.07 D |
ab 36,00 €
DLin-MC2-DMA
Artikelnummer: Cay39731-1
DLin-MC2-DMA is an ionizable cationic lipid (pKa = 5.64) that has been used in the formation of lipid nanoparticles (LNPs). LNPs containing DLin-MC2-DMA and encapsulating siRNA targeting mRNA encoding mouse coagulation Factor VII (FVII) reduce hepatic levels of FVII in mice (ED50 = 0.6 mg/kg).Formal Name:...
| Schlagworte: | MC2, N,N-dimethyl-beta-alanine (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester |
| Anwendung: | Ionizable cationic lipid, LNP formation |
| CAS | 1221271-55-1 |
| MW: | 628.1 D |
ab 38,00 €
