Zu "1221186-52-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML202
Artikelnummer: TGM-T73525-10mg
Description: ML202 is a highly specific allosteric activator of human pyruvate kinase M2 (hPK-M2), enhancing the cooperativity of phosphoenolpyruvate (PEP) binding with negligible effect on adenosine diphosphate (ADP) binding. Target: Others. Smiles: CN1C2=C(C3=C1C(=O)N(CC4=CC(OC)=CC=C4)N=C3)SC(S(C)=O)=C2
| Anwendung: | PKM2 activator |
| CAS | 1221186-52-2 |
| MW: | 387.48 D |
ab 88,00 €
ML-202
Artikelnummer: Cay37326-1
ML-202 is an activator of pyruvate kinase M2 (PKM2). It induces PMK2 activation in a cell-free assay with a 50% activation concentration (AC50) value of 73 nM.Formal Name: 4,6-dihydro-6-[(3-methoxyphenyl)methyl]-4-methyl-2-(methylsulfinyl)-5H-thieno[2',3':4,5]pyrrolo[2,3-d]pyridazin-5-one. CAS Number: 1221186-52-2....
| Schlagworte: | 4,6-dihydro-6-[(3-methoxyphenyl)methyl]-4-methyl-2-(methylsulfinyl)-5H-thieno[2',3':4,5]pyrrolo[2,3-d]pyridazin-5-one |
| Anwendung: | PKM2 activator |
| CAS | 1221186-52-2 |
| MW: | 387.5 D |
ab 53,00 €
