Zu "1219739-36-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
EX-229
Artikelnummer: Cay34690-5
EX-229 is an activator of AMP-activated protein kinase (AMPK). It activates AMPK and increases glucose uptake in isolated rat epitrochlearis muscle when used at a concentration of 100 µM. EX-229 also increases AMPK activation and glucose uptake in primary skeletal muscle cultures isolated from patients with myalgic...
| Schlagworte: | AMPK Activator 991, 5-[[6-chloro-5-(1-methyl-1H-indol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methyl-benzoic acid |
| Anwendung: | AMPK activator |
| CAS | 1219739-36-2 |
| MW: | 431.9 D |
ab 69,00 €
EX229
Artikelnummer: TGM-TQ0028-100mg
Description: EX229 (C991) is an allosteric activator of AMPK, with Kds of 0.06 µM, 0.06 µM and 0.51 µM for alpha1beta1gamma1, alpha2beta1gamma1, and alpha1beta2gamma1, respectively. Target: AMPK. Smiles: Cc1ccc(Oc2nc3cc(c(Cl)cc3[nH]2)-c2ccc3n(C)ccc3c2)cc1C(O)=O. References: Xiao B, et al. Structural basis of AMPK...
| Schlagworte: | Compound 991, C991 |
| Anwendung: | AMPK activator |
| CAS | 1219739-36-2 |
| MW: | 431.87 D |
ab 30,00 €
