Zu "1219038-31-9" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Linoleic Acid Alkyne
Linoleic Acid Alkyne

Artikelnummer: Cay10541-1

Linoleic acid alkyne is an omega-alkyne derivative of linoleic acid (Cay-90150). The omega-alkyne moiety allows Cu(I)-catalyzed cycloaddition chemistry with other molecules containing an azide group. Linoleic acid alkyne has been used in experiments focusing on the biological roles of linoleic acid. Alternatively,...
Schlagworte: 9Z,12Z-octadecadien-17-ynoic acid
Anwendung: Lipid studies, click chemistry
CAS 1219038-31-9
MW: 276.4 D
ab 85,00 €
Bewerten
Linoleic acid alkyne
Linoleic acid alkyne

Artikelnummer: TGM-TN7561-10mg

Description: Linoleic acid alkyne, an omega-alkyne derivative of Linoleic acid, serves as a precursor for synthesizing alkyne-containing compounds, including glycerophospholipids, suited for click chemistry applications [1]. Target: Others. Smiles: OC(=O)CCCCCCC\C=C/C\C=C/CCCC#C
Schlagworte: Click TagTM Linoleic Acid Alkyne
CAS 1219038-31-9
MW: 276.42 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten